C28H30Cl2N2O4 — CID 53300239
ethyl (3S,4aS)-3-[2-(benzylamino)-2-oxoethyl]-1-[(2,4-dichlorophenyl)methyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate (PubChem CID 53300239) has the molecular formula C28H30Cl2N2O4 and a molecular weight of 529.46 g/mol. Its IUPAC name is ethyl (3S,4aS)-3-[2-(benzylamino)-2-oxoethyl]-1-[(2,4-dichlorophenyl)methyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate.
| Compound Name | ethyl (3S,4aS)-3-[2-(benzylamino)-2-oxoethyl]-1-[(2,4-dichlorophenyl)methyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53300239 |
| Molecular Formula | C28H30Cl2N2O4 |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | ethyl (3S,4aS)-3-[2-(benzylamino)-2-oxoethyl]-1-[(2,4-dichlorophenyl)methyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCC=C1N(Cc1ccc(Cl)cc1Cl)C(=O)[C@H](CC(=O)NCc1ccccc1)C2 |
| InChI | InChI=1S/C28H30Cl2N2O4/c1-2-36-27(35)28-13-7-6-10-24(28)32(18-20-11-12-22(29)15-23(20)30)26(34)21(16-28)14-25(33)31-17-19-8-4-3-5-9-19/h3-5,8-12,15,21H,2,6-7,13-14,16-18H2,1H3,(H,31,33)/t21-,28+/m1/s1 |
| InChIKey | SDLFWAYMNMLTHV-PIKZIKFNSA-N |
| XLogP | 5.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |