C20H26N2O4 — CID 53300600
methyl 5-[(4S,6R)-3-oxo-6-(2-phenylethyl)-2,4,6,7-tetrahydro-1H-pyrano[4,3-c]pyrazol-4-yl]pentanoate (PubChem CID 53300600) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is methyl 5-[(4S,6R)-3-oxo-6-(2-phenylethyl)-2,4,6,7-tetrahydro-1H-pyrano[4,3-c]pyrazol-4-yl]pentanoate.
| Compound Name | methyl 5-[(4S,6R)-3-oxo-6-(2-phenylethyl)-2,4,6,7-tetrahydro-1H-pyrano[4,3-c]pyrazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 53300600 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | methyl 5-[(4S,6R)-3-oxo-6-(2-phenylethyl)-2,4,6,7-tetrahydro-1H-pyrano[4,3-c]pyrazol-4-yl]pentanoate |
| SMILES | COC(=O)CCCC[C@@H]1O[C@H](CCc2ccccc2)Cc2[nH][nH]c(=O)c21 |
| InChI | InChI=1S/C20H26N2O4/c1-25-18(23)10-6-5-9-17-19-16(21-22-20(19)24)13-15(26-17)12-11-14-7-3-2-4-8-14/h2-4,7-8,15,17H,5-6,9-13H2,1H3,(H2,21,22,24)/t15-,17+/m1/s1 |
| InChIKey | SRCSRASPZCCNNA-WBVHZDCISA-N |
| XLogP | 3.05 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|