About N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine
N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine (PubChem CID 53300687) has the molecular formula C34H32NOP
and a molecular weight of 501.61 g/mol. Its IUPAC name is N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine.
Molecular Properties
| Compound Name | N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine |
| PubChem CID | 53300687 |
| Molecular Formula | C34H32NOP |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine |
| SMILES | Cc1ccc(P(=O)(c2ccc(C)cc2)[C@@H](NC(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H32NOP/c1-26-18-22-31(23-19-26)37(36,32-24-20-27(2)21-25-32)34(30-16-10-5-11-17-30)35-33(28-12-6-3-7-13-28)29-14-8-4-9-15-29/h3-25,33-35H,1-2H3/t34-/m1/s1 |
| InChIKey | RFDOOXPSHPWXHP-UUWRZZSWSA-N |
| XLogP | 7.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine?
The IUPAC name of N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine (CID 53300687) is N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine.
What is the SMILES notation for N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine?
The canonical SMILES for N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine is Cc1ccc(P(=O)(c2ccc(C)cc2)[C@@H](NC(c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine?
The InChIKey is RFDOOXPSHPWXHP-UUWRZZSWSA-N. The full InChI is InChI=1S/C34H32NOP/c1-26-18-22-31(23-19-26)37(36,32-24-20-27(2)21-25-32)34(30-16-10-5-11-17-30)35-33(28-12-6-3-7-13-28)29-14-8-4-9-15-29/h3-25,33-35H,1-2H3/t34-/m1/s1.
What are the key properties of N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine?
N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine has a molecular weight of 501.61 g/mol, XLogP of 7.70, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(R)-bis(4-methylphenyl)phosphoryl-phenylmethyl]-1,1-diphenylmethanamine is sourced from PubChem (CID 53300687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).