About N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine
N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine (PubChem CID 53301198) has the molecular formula C16H26N4
and a molecular weight of 274.41 g/mol. Its IUPAC name is N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine.
Molecular Properties
| Compound Name | N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine |
| PubChem CID | 53301198 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine |
| SMILES | CCCCNc1c(CC(C)C)nc2nc(C)cc(C)n12 |
| InChI | InChI=1S/C16H26N4/c1-6-7-8-17-15-14(9-11(2)3)19-16-18-12(4)10-13(5)20(15)16/h10-11,17H,6-9H2,1-5H3 |
| InChIKey | HXCGAHCICYJTFL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine?
The IUPAC name of N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine (CID 53301198) is N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine.
What is the SMILES notation for N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine?
The canonical SMILES for N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine is CCCCNc1c(CC(C)C)nc2nc(C)cc(C)n12.
What is the InChIKey of N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine?
The InChIKey is HXCGAHCICYJTFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4/c1-6-7-8-17-15-14(9-11(2)3)19-16-18-12(4)10-13(5)20(15)16/h10-11,17H,6-9H2,1-5H3.
What are the key properties of N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine?
N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine has a molecular weight of 274.41 g/mol, XLogP of 3.76, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-5,7-dimethyl-2-(2-methylpropyl)imidazo[1,2-a]pyrimidin-3-amine is sourced from PubChem (CID 53301198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).