C24H26ClNO3 — CID 53301243
ethyl (6aR,11aS)-9-chloro-5-oxo-6-pentyl-6a,11-dihydroindeno[1,2-c]isoquinoline-11a-carboxylate (PubChem CID 53301243) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is ethyl (6aR,11aS)-9-chloro-5-oxo-6-pentyl-6a,11-dihydroindeno[1,2-c]isoquinoline-11a-carboxylate.
| Compound Name | ethyl (6aR,11aS)-9-chloro-5-oxo-6-pentyl-6a,11-dihydroindeno[1,2-c]isoquinoline-11a-carboxylate |
|---|---|
| PubChem CID | 53301243 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | ethyl (6aR,11aS)-9-chloro-5-oxo-6-pentyl-6a,11-dihydroindeno[1,2-c]isoquinoline-11a-carboxylate |
| SMILES | CCCCCN1C(=O)c2ccccc2[C@@]2(C(=O)OCC)Cc3cc(Cl)ccc3[C@@H]12 |
| InChI | InChI=1S/C24H26ClNO3/c1-3-5-8-13-26-21-18-12-11-17(25)14-16(18)15-24(21,23(28)29-4-2)20-10-7-6-9-19(20)22(26)27/h6-7,9-12,14,21H,3-5,8,13,15H2,1-2H3/t21-,24+/m1/s1 |
| InChIKey | KAYRWXZLQMBEJR-QPPBQGQZSA-N |
| XLogP | 5.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|