C25H29NO4 — CID 53301244
ethyl (6aR,11aS)-9-methoxy-5-oxo-6-pentyl-6a,11-dihydroindeno[1,2-c]isoquinoline-11a-carboxylate (PubChem CID 53301244) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is ethyl (6aR,11aS)-9-methoxy-5-oxo-6-pentyl-6a,11-dihydroindeno[1,2-c]isoquinoline-11a-carboxylate.
| Compound Name | ethyl (6aR,11aS)-9-methoxy-5-oxo-6-pentyl-6a,11-dihydroindeno[1,2-c]isoquinoline-11a-carboxylate |
|---|---|
| PubChem CID | 53301244 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | ethyl (6aR,11aS)-9-methoxy-5-oxo-6-pentyl-6a,11-dihydroindeno[1,2-c]isoquinoline-11a-carboxylate |
| SMILES | CCCCCN1C(=O)c2ccccc2[C@@]2(C(=O)OCC)Cc3cc(OC)ccc3[C@@H]12 |
| InChI | InChI=1S/C25H29NO4/c1-4-6-9-14-26-22-19-13-12-18(29-3)15-17(19)16-25(22,24(28)30-5-2)21-11-8-7-10-20(21)23(26)27/h7-8,10-13,15,22H,4-6,9,14,16H2,1-3H3/t22-,25+/m1/s1 |
| InChIKey | JOBAMDLRCCZKTP-RDGATRHJSA-N |
| XLogP | 4.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|