C27H37N7O3 — CID 5330126
1-[3-(3,5-dimethoxyphenyl)-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]-3-ethylurea (PubChem CID 5330126) has the molecular formula C27H37N7O3 and a molecular weight of 507.64 g/mol. Its IUPAC name is 1-[3-(3,5-dimethoxyphenyl)-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]-3-ethylurea.
| Compound Name | 1-[3-(3,5-dimethoxyphenyl)-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]-3-ethylurea |
|---|---|
| PubChem CID | 5330126 |
| Molecular Formula | C27H37N7O3 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | 1-[3-(3,5-dimethoxyphenyl)-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2cc(NCCCN3CCN(C)CC3)ncc2cc1-c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C27H37N7O3/c1-5-28-27(35)32-26-23(19-13-21(36-3)16-22(14-19)37-4)15-20-18-30-25(17-24(20)31-26)29-7-6-8-34-11-9-33(2)10-12-34/h13-18H,5-12H2,1-4H3,(H,29,30)(H2,28,31,32,35) |
| InChIKey | KZMWAICISUWYLE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|