C29H40N6O4 — CID 5330129
1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-(4-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-yl]urea (PubChem CID 5330129) has the molecular formula C29H40N6O4 and a molecular weight of 536.68 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-(4-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-yl]urea.
| Compound Name | 1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-(4-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 5330129 |
| Molecular Formula | C29H40N6O4 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | 1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-(4-morpholin-4-ylbutylamino)-1,6-naphthyridin-2-yl]urea |
| SMILES | COc1cc(OC)cc(-c2cc3cnc(NCCCCN4CCOCC4)cc3nc2NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C29H40N6O4/c1-29(2,3)34-28(36)33-27-24(20-14-22(37-4)17-23(15-20)38-5)16-21-19-31-26(18-25(21)32-27)30-8-6-7-9-35-10-12-39-13-11-35/h14-19H,6-13H2,1-5H3,(H,30,31)(H2,32,33,34,36) |
| InChIKey | YEIRROBVFZDCIW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 109.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|