C30H43N7O3 — CID 5330130
1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-[4-(4-methylpiperazin-1-yl)butylamino]-1,6-naphthyridin-2-yl]urea (PubChem CID 5330130) has the molecular formula C30H43N7O3 and a molecular weight of 549.72 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-[4-(4-methylpiperazin-1-yl)butylamino]-1,6-naphthyridin-2-yl]urea.
| Compound Name | 1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-[4-(4-methylpiperazin-1-yl)butylamino]-1,6-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 5330130 |
| Molecular Formula | C30H43N7O3 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | 1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-[4-(4-methylpiperazin-1-yl)butylamino]-1,6-naphthyridin-2-yl]urea |
| SMILES | COc1cc(OC)cc(-c2cc3cnc(NCCCCN4CCN(C)CC4)cc3nc2NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C30H43N7O3/c1-30(2,3)35-29(38)34-28-25(21-15-23(39-5)18-24(16-21)40-6)17-22-20-32-27(19-26(22)33-28)31-9-7-8-10-37-13-11-36(4)12-14-37/h15-20H,7-14H2,1-6H3,(H,31,32)(H2,33,34,35,38) |
| InChIKey | RAMCMRRBGWIDLK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|