C27H37N7O — CID 5330138
1-tert-butyl-3-[7-[3-(4-methylpiperazin-1-yl)propylamino]-3-phenyl-1,6-naphthyridin-2-yl]urea (PubChem CID 5330138) has the molecular formula C27H37N7O and a molecular weight of 475.64 g/mol. Its IUPAC name is 1-tert-butyl-3-[7-[3-(4-methylpiperazin-1-yl)propylamino]-3-phenyl-1,6-naphthyridin-2-yl]urea.
| Compound Name | 1-tert-butyl-3-[7-[3-(4-methylpiperazin-1-yl)propylamino]-3-phenyl-1,6-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 5330138 |
| Molecular Formula | C27H37N7O |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | 1-tert-butyl-3-[7-[3-(4-methylpiperazin-1-yl)propylamino]-3-phenyl-1,6-naphthyridin-2-yl]urea |
| SMILES | CN1CCN(CCCNc2cc3nc(NC(=O)NC(C)(C)C)c(-c4ccccc4)cc3cn2)CC1 |
| InChI | InChI=1S/C27H37N7O/c1-27(2,3)32-26(35)31-25-22(20-9-6-5-7-10-20)17-21-19-29-24(18-23(21)30-25)28-11-8-12-34-15-13-33(4)14-16-34/h5-7,9-10,17-19H,8,11-16H2,1-4H3,(H,28,29)(H2,30,31,32,35) |
| InChIKey | YHWIDOWCIUQFLW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|