C30H44N8 — CID 5330139
2-N,7-N-bis[3-(4-methylpiperazin-1-yl)propyl]-3-phenyl-1,6-naphthyridine-2,7-diamine (PubChem CID 5330139) has the molecular formula C30H44N8 and a molecular weight of 516.74 g/mol. Its IUPAC name is 2-N,7-N-bis[3-(4-methylpiperazin-1-yl)propyl]-3-phenyl-1,6-naphthyridine-2,7-diamine.
| Compound Name | 2-N,7-N-bis[3-(4-methylpiperazin-1-yl)propyl]-3-phenyl-1,6-naphthyridine-2,7-diamine |
|---|---|
| PubChem CID | 5330139 |
| Molecular Formula | C30H44N8 |
| Molecular Weight | 516.74 g/mol |
| Exact Mass | 516.37 |
| IUPAC Name | 2-N,7-N-bis[3-(4-methylpiperazin-1-yl)propyl]-3-phenyl-1,6-naphthyridine-2,7-diamine |
| SMILES | CN1CCN(CCCNc2cc3nc(NCCCN4CCN(C)CC4)c(-c4ccccc4)cc3cn2)CC1 |
| InChI | InChI=1S/C30H44N8/c1-35-14-18-37(19-15-35)12-6-10-31-29-23-28-26(24-33-29)22-27(25-8-4-3-5-9-25)30(34-28)32-11-7-13-38-20-16-36(2)17-21-38/h3-5,8-9,22-24H,6-7,10-21H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | FYWYYGLUFUROPO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|