C27H38N6O — CID 5330141
1-tert-butyl-3-[7-[4-(diethylamino)butylamino]-3-phenyl-1,6-naphthyridin-2-yl]urea (PubChem CID 5330141) has the molecular formula C27H38N6O and a molecular weight of 462.64 g/mol. Its IUPAC name is 1-tert-butyl-3-[7-[4-(diethylamino)butylamino]-3-phenyl-1,6-naphthyridin-2-yl]urea.
| Compound Name | 1-tert-butyl-3-[7-[4-(diethylamino)butylamino]-3-phenyl-1,6-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 5330141 |
| Molecular Formula | C27H38N6O |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | 1-tert-butyl-3-[7-[4-(diethylamino)butylamino]-3-phenyl-1,6-naphthyridin-2-yl]urea |
| SMILES | CCN(CC)CCCCNc1cc2nc(NC(=O)NC(C)(C)C)c(-c3ccccc3)cc2cn1 |
| InChI | InChI=1S/C27H38N6O/c1-6-33(7-2)16-12-11-15-28-24-18-23-21(19-29-24)17-22(20-13-9-8-10-14-20)25(30-23)31-26(34)32-27(3,4)5/h8-10,13-14,17-19H,6-7,11-12,15-16H2,1-5H3,(H,28,29)(H2,30,31,32,34) |
| InChIKey | GMRQZYNUHURXII-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|