C25H31Cl2N7O — CID 5330143
1-[3-(2,6-dichlorophenyl)-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]-3-ethylurea (PubChem CID 5330143) has the molecular formula C25H31Cl2N7O and a molecular weight of 516.48 g/mol. Its IUPAC name is 1-[3-(2,6-dichlorophenyl)-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]-3-ethylurea.
| Compound Name | 1-[3-(2,6-dichlorophenyl)-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]-3-ethylurea |
|---|---|
| PubChem CID | 5330143 |
| Molecular Formula | C25H31Cl2N7O |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 1-[3-(2,6-dichlorophenyl)-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2cc(NCCCN3CCN(C)CC3)ncc2cc1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H31Cl2N7O/c1-3-28-25(35)32-24-18(23-19(26)6-4-7-20(23)27)14-17-16-30-22(15-21(17)31-24)29-8-5-9-34-12-10-33(2)11-13-34/h4,6-7,14-16H,3,5,8-13H2,1-2H3,(H,29,30)(H2,28,31,32,35) |
| InChIKey | WQZLHIFJXAIOQL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|