C27H35Cl2N7O — CID 5330144
1-tert-butyl-3-[3-(2,6-dichlorophenyl)-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]urea (PubChem CID 5330144) has the molecular formula C27H35Cl2N7O and a molecular weight of 544.53 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(2,6-dichlorophenyl)-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]urea.
| Compound Name | 1-tert-butyl-3-[3-(2,6-dichlorophenyl)-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 5330144 |
| Molecular Formula | C27H35Cl2N7O |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 1-tert-butyl-3-[3-(2,6-dichlorophenyl)-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-yl]urea |
| SMILES | CN1CCN(CCCNc2cc3nc(NC(=O)NC(C)(C)C)c(-c4c(Cl)cccc4Cl)cc3cn2)CC1 |
| InChI | InChI=1S/C27H35Cl2N7O/c1-27(2,3)34-26(37)33-25-19(24-20(28)7-5-8-21(24)29)15-18-17-31-23(16-22(18)32-25)30-9-6-10-36-13-11-35(4)12-14-36/h5,7-8,15-17H,6,9-14H2,1-4H3,(H,30,31)(H2,32,33,34,37) |
| InChIKey | TWGNTRGLYZCJJT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|