C25H32Cl2N6O — CID 5330146
1-[3-(2,6-dichlorophenyl)-7-[4-(diethylamino)butylamino]-1,6-naphthyridin-2-yl]-3-ethylurea (PubChem CID 5330146) has the molecular formula C25H32Cl2N6O and a molecular weight of 503.48 g/mol. Its IUPAC name is 1-[3-(2,6-dichlorophenyl)-7-[4-(diethylamino)butylamino]-1,6-naphthyridin-2-yl]-3-ethylurea.
| Compound Name | 1-[3-(2,6-dichlorophenyl)-7-[4-(diethylamino)butylamino]-1,6-naphthyridin-2-yl]-3-ethylurea |
|---|---|
| PubChem CID | 5330146 |
| Molecular Formula | C25H32Cl2N6O |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 1-[3-(2,6-dichlorophenyl)-7-[4-(diethylamino)butylamino]-1,6-naphthyridin-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2cc(NCCCCN(CC)CC)ncc2cc1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H32Cl2N6O/c1-4-28-25(34)32-24-18(23-19(26)10-9-11-20(23)27)14-17-16-30-22(15-21(17)31-24)29-12-7-8-13-33(5-2)6-3/h9-11,14-16H,4-8,12-13H2,1-3H3,(H,29,30)(H2,28,31,32,34) |
| InChIKey | QVJHVQPCRIXTMX-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|