C27H36Cl2N6O — CID 5330147
1-tert-butyl-3-[3-(2,6-dichlorophenyl)-7-[4-(diethylamino)butylamino]-1,6-naphthyridin-2-yl]urea (PubChem CID 5330147) has the molecular formula C27H36Cl2N6O and a molecular weight of 531.53 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(2,6-dichlorophenyl)-7-[4-(diethylamino)butylamino]-1,6-naphthyridin-2-yl]urea.
| Compound Name | 1-tert-butyl-3-[3-(2,6-dichlorophenyl)-7-[4-(diethylamino)butylamino]-1,6-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 5330147 |
| Molecular Formula | C27H36Cl2N6O |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 1-tert-butyl-3-[3-(2,6-dichlorophenyl)-7-[4-(diethylamino)butylamino]-1,6-naphthyridin-2-yl]urea |
| SMILES | CCN(CC)CCCCNc1cc2nc(NC(=O)NC(C)(C)C)c(-c3c(Cl)cccc3Cl)cc2cn1 |
| InChI | InChI=1S/C27H36Cl2N6O/c1-6-35(7-2)14-9-8-13-30-23-16-22-18(17-31-23)15-19(24-20(28)11-10-12-21(24)29)25(32-22)33-26(36)34-27(3,4)5/h10-12,15-17H,6-9,13-14H2,1-5H3,(H,30,31)(H2,32,33,34,36) |
| InChIKey | WLFMHNCEKPWCEA-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|