C33H39N5O5 — CID 5330148
N-[2-(tert-butylcarbamoylamino)-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-7-yl]-N-(3-phenylmethoxypropyl)acetamide (PubChem CID 5330148) has the molecular formula C33H39N5O5 and a molecular weight of 585.71 g/mol. Its IUPAC name is N-[2-(tert-butylcarbamoylamino)-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-7-yl]-N-(3-phenylmethoxypropyl)acetamide.
| Compound Name | N-[2-(tert-butylcarbamoylamino)-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-7-yl]-N-(3-phenylmethoxypropyl)acetamide |
|---|---|
| PubChem CID | 5330148 |
| Molecular Formula | C33H39N5O5 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | N-[2-(tert-butylcarbamoylamino)-3-(3,5-dimethoxyphenyl)-1,6-naphthyridin-7-yl]-N-(3-phenylmethoxypropyl)acetamide |
| SMILES | COc1cc(OC)cc(-c2cc3cnc(N(CCCOCc4ccccc4)C(C)=O)cc3nc2NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C33H39N5O5/c1-22(39)38(13-10-14-43-21-23-11-8-7-9-12-23)30-19-29-25(20-34-30)17-28(24-15-26(41-5)18-27(16-24)42-6)31(35-29)36-32(40)37-33(2,3)4/h7-9,11-12,15-20H,10,13-14,21H2,1-6H3,(H2,35,36,37,40) |
| InChIKey | ZXBIAWLOGMFTPF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|