About 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol
2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol (PubChem CID 53301500) has the molecular formula C19H20O4S
and a molecular weight of 344.43 g/mol. Its IUPAC name is 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol |
| PubChem CID | 53301500 |
| Molecular Formula | C19H20O4S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol |
| SMILES | COc1cc(-c2c(CCO)sc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C19H20O4S/c1-21-14-10-12(11-15(22-2)19(14)23-3)18-13-6-4-5-7-16(13)24-17(18)8-9-20/h4-7,10-11,20H,8-9H2,1-3H3 |
| InChIKey | JOGYFVSTYHTMTI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol?
The IUPAC name of 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol (CID 53301500) is 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol.
What is the SMILES notation for 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol?
The canonical SMILES for 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol is COc1cc(-c2c(CCO)sc3ccccc23)cc(OC)c1OC.
What is the InChIKey of 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol?
The InChIKey is JOGYFVSTYHTMTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O4S/c1-21-14-10-12(11-15(22-2)19(14)23-3)18-13-6-4-5-7-16(13)24-17(18)8-9-20/h4-7,10-11,20H,8-9H2,1-3H3.
What are the key properties of 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol?
2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol has a molecular weight of 344.43 g/mol, XLogP of 4.13, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,4,5-trimethoxyphenyl)-1-benzothiophen-2-yl]ethanol is sourced from PubChem (CID 53301500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).