C23H24O5 — CID 53301520
5-[4-(4-hydroxybutoxy)-2-phenyl-4,5,6,7-tetrahydro-1-benzofuran-3-yl]furan-2-carbaldehyde (PubChem CID 53301520) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is 5-[4-(4-hydroxybutoxy)-2-phenyl-4,5,6,7-tetrahydro-1-benzofuran-3-yl]furan-2-carbaldehyde.
| Compound Name | 5-[4-(4-hydroxybutoxy)-2-phenyl-4,5,6,7-tetrahydro-1-benzofuran-3-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 53301520 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 5-[4-(4-hydroxybutoxy)-2-phenyl-4,5,6,7-tetrahydro-1-benzofuran-3-yl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2c(-c3ccccc3)oc3c2C(OCCCCO)CCC3)o1 |
| InChI | InChI=1S/C23H24O5/c24-13-4-5-14-26-18-9-6-10-19-21(18)22(20-12-11-17(15-25)27-20)23(28-19)16-7-2-1-3-8-16/h1-3,7-8,11-12,15,18,24H,4-6,9-10,13-14H2 |
| InChIKey | LFBVATGGCVUOEJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|