C20H18BrNO3 — CID 53301533
3-(6-bromo-3-pyridinyl)-2-(3-methoxyphenyl)-4,5,6,7-tetrahydro-1-benzofuran-4-ol (PubChem CID 53301533) has the molecular formula C20H18BrNO3 and a molecular weight of 400.27 g/mol. Its IUPAC name is 3-(6-bromo-3-pyridinyl)-2-(3-methoxyphenyl)-4,5,6,7-tetrahydro-1-benzofuran-4-ol.
| Compound Name | 3-(6-bromo-3-pyridinyl)-2-(3-methoxyphenyl)-4,5,6,7-tetrahydro-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 53301533 |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 3-(6-bromo-3-pyridinyl)-2-(3-methoxyphenyl)-4,5,6,7-tetrahydro-1-benzofuran-4-ol |
| SMILES | COc1cccc(-c2oc3c(c2-c2ccc(Br)nc2)C(O)CCC3)c1 |
| InChI | InChI=1S/C20H18BrNO3/c1-24-14-5-2-4-12(10-14)20-18(13-8-9-17(21)22-11-13)19-15(23)6-3-7-16(19)25-20/h2,4-5,8-11,15,23H,3,6-7H2,1H3 |
| InChIKey | IUQLYIMUCGEBQT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|