C24H31N5O4 — CID 5330157
1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-(3-hydroxypropylamino)-1,6-naphthyridin-2-yl]urea (PubChem CID 5330157) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-(3-hydroxypropylamino)-1,6-naphthyridin-2-yl]urea.
| Compound Name | 1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-(3-hydroxypropylamino)-1,6-naphthyridin-2-yl]urea |
|---|---|
| PubChem CID | 5330157 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 1-tert-butyl-3-[3-(3,5-dimethoxyphenyl)-7-(3-hydroxypropylamino)-1,6-naphthyridin-2-yl]urea |
| SMILES | COc1cc(OC)cc(-c2cc3cnc(NCCCO)cc3nc2NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C24H31N5O4/c1-24(2,3)29-23(31)28-22-19(15-9-17(32-4)12-18(10-15)33-5)11-16-14-26-21(13-20(16)27-22)25-7-6-8-30/h9-14,30H,6-8H2,1-5H3,(H,25,26)(H2,27,28,29,31) |
| InChIKey | JAYZLGOACZERIJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|