C30H37N3O4S — CID 53301573
(3R)-1-[(4S)-1,1-dioxo-2-[(1R)-1-phenylethyl]-4-(phenylmethoxymethyl)-3,4-dihydro-5,1λ6,2-benzoxathiazepin-7-yl]-N,N-dimethylpyrrolidin-3-amine (PubChem CID 53301573) has the molecular formula C30H37N3O4S and a molecular weight of 535.71 g/mol. Its IUPAC name is (3R)-1-[(4S)-1,1-dioxo-2-[(1R)-1-phenylethyl]-4-(phenylmethoxymethyl)-3,4-dihydro-5,1λ6,2-benzoxathiazepin-7-yl]-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | (3R)-1-[(4S)-1,1-dioxo-2-[(1R)-1-phenylethyl]-4-(phenylmethoxymethyl)-3,4-dihydro-5,1λ6,2-benzoxathiazepin-7-yl]-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 53301573 |
| Molecular Formula | C30H37N3O4S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | (3R)-1-[(4S)-1,1-dioxo-2-[(1R)-1-phenylethyl]-4-(phenylmethoxymethyl)-3,4-dihydro-5,1λ6,2-benzoxathiazepin-7-yl]-N,N-dimethylpyrrolidin-3-amine |
| SMILES | C[C@H](c1ccccc1)N1C[C@@H](COCc2ccccc2)Oc2cc(N3CC[C@@H](N(C)C)C3)ccc2S1(=O)=O |
| InChI | InChI=1S/C30H37N3O4S/c1-23(25-12-8-5-9-13-25)33-20-28(22-36-21-24-10-6-4-7-11-24)37-29-18-26(14-15-30(29)38(33,34)35)32-17-16-27(19-32)31(2)3/h4-15,18,23,27-28H,16-17,19-22H2,1-3H3/t23-,27-,28+/m1/s1 |
| InChIKey | YTZINVIEDLWFGL-QPVYNBJUSA-N |
| XLogP | 4.56 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |