C26H36N8O3 — CID 5330166
1-[6-(3,5-dimethoxyphenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-ethylurea (PubChem CID 5330166) has the molecular formula C26H36N8O3 and a molecular weight of 508.63 g/mol. Its IUPAC name is 1-[6-(3,5-dimethoxyphenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-ethylurea.
| Compound Name | 1-[6-(3,5-dimethoxyphenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-ethylurea |
|---|---|
| PubChem CID | 5330166 |
| Molecular Formula | C26H36N8O3 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | 1-[6-(3,5-dimethoxyphenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2nc(NCCCN3CCN(C)CC3)ncc2cc1-c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C26H36N8O3/c1-5-27-26(35)32-24-22(18-13-20(36-3)16-21(14-18)37-4)15-19-17-29-25(31-23(19)30-24)28-7-6-8-34-11-9-33(2)10-12-34/h13-17H,5-12H2,1-4H3,(H3,27,28,29,30,31,32,35) |
| InChIKey | FQQPROZCOUSSJP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|