C28H40N8O3 — CID 5330167
1-tert-butyl-3-[6-(3,5-dimethoxyphenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 5330167) has the molecular formula C28H40N8O3 and a molecular weight of 536.68 g/mol. Its IUPAC name is 1-tert-butyl-3-[6-(3,5-dimethoxyphenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-tert-butyl-3-[6-(3,5-dimethoxyphenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 5330167 |
| Molecular Formula | C28H40N8O3 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | 1-tert-butyl-3-[6-(3,5-dimethoxyphenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | COc1cc(OC)cc(-c2cc3cnc(NCCCN4CCN(C)CC4)nc3nc2NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C28H40N8O3/c1-28(2,3)34-27(37)33-25-23(19-14-21(38-5)17-22(15-19)39-6)16-20-18-30-26(32-24(20)31-25)29-8-7-9-36-12-10-35(4)11-13-36/h14-18H,7-13H2,1-6H3,(H3,29,30,31,32,33,34,37) |
| InChIKey | VYWXBPWMVHMUQW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|