C26H37N7O3 — CID 5330168
1-[2-[4-(diethylamino)butylamino]-6-(3,5-dimethoxyphenyl)pyrido[2,3-d]pyrimidin-7-yl]-3-ethylurea (PubChem CID 5330168) has the molecular formula C26H37N7O3 and a molecular weight of 495.63 g/mol. Its IUPAC name is 1-[2-[4-(diethylamino)butylamino]-6-(3,5-dimethoxyphenyl)pyrido[2,3-d]pyrimidin-7-yl]-3-ethylurea.
| Compound Name | 1-[2-[4-(diethylamino)butylamino]-6-(3,5-dimethoxyphenyl)pyrido[2,3-d]pyrimidin-7-yl]-3-ethylurea |
|---|---|
| PubChem CID | 5330168 |
| Molecular Formula | C26H37N7O3 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | 1-[2-[4-(diethylamino)butylamino]-6-(3,5-dimethoxyphenyl)pyrido[2,3-d]pyrimidin-7-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2nc(NCCCCN(CC)CC)ncc2cc1-c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C26H37N7O3/c1-6-27-26(34)32-24-22(18-13-20(35-4)16-21(14-18)36-5)15-19-17-29-25(31-23(19)30-24)28-11-9-10-12-33(7-2)8-3/h13-17H,6-12H2,1-5H3,(H3,27,28,29,30,31,32,34) |
| InChIKey | CHYRHTDWXRVJMJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|