About 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile
4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile (PubChem CID 53302005) has the molecular formula C14H9N3
and a molecular weight of 219.25 g/mol. Its IUPAC name is 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile.
Molecular Properties
| Compound Name | 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile |
| PubChem CID | 53302005 |
| Molecular Formula | C14H9N3 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile |
| SMILES | N#Cc1ccc(-n2ccc3cccnc32)cc1 |
| InChI | InChI=1S/C14H9N3/c15-10-11-3-5-13(6-4-11)17-9-7-12-2-1-8-16-14(12)17/h1-9H |
| InChIKey | PINRRCFXMRVJBZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile?
The IUPAC name of 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile (CID 53302005) is 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile.
What is the SMILES notation for 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile?
The canonical SMILES for 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile is N#Cc1ccc(-n2ccc3cccnc32)cc1.
What is the InChIKey of 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile?
The InChIKey is PINRRCFXMRVJBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3/c15-10-11-3-5-13(6-4-11)17-9-7-12-2-1-8-16-14(12)17/h1-9H.
What are the key properties of 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile?
4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile has a molecular weight of 219.25 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrrolo[2,3-b]pyridin-1-ylbenzonitrile is sourced from PubChem (CID 53302005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).