C10H19FN2O2 — CID 53302083
tert-butyl N-[(3R,4R)-3-fluoropiperidin-4-yl]carbamate (PubChem CID 53302083) has the molecular formula C10H19FN2O2 and a molecular weight of 218.27 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-3-fluoropiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-3-fluoropiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 53302083 |
| Molecular Formula | C10H19FN2O2 |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | tert-butyl N-[(3R,4R)-3-fluoropiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCNC[C@H]1F |
| InChI | InChI=1S/C10H19FN2O2/c1-10(2,3)15-9(14)13-8-4-5-12-6-7(8)11/h7-8,12H,4-6H2,1-3H3,(H,13,14)/t7-,8-/m1/s1 |
| InChIKey | MPIIBGAKGQZLDK-HTQZYQBOSA-N |
| XLogP | 1.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |