C17H14F4N4O2 — CID 5330209
8-ethyl-2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 5330209) has the molecular formula C17H14F4N4O2 and a molecular weight of 382.32 g/mol. Its IUPAC name is 8-ethyl-2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-ethyl-2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5330209 |
| Molecular Formula | C17H14F4N4O2 |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 8-ethyl-2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)ccc2cnc(Nc3cccc(OC(F)(F)C(F)F)c3)nc21 |
| InChI | InChI=1S/C17H14F4N4O2/c1-2-25-13(26)7-6-10-9-22-16(24-14(10)25)23-11-4-3-5-12(8-11)27-17(20,21)15(18)19/h3-9,15H,2H2,1H3,(H,22,23,24) |
| InChIKey | IIFSTQQBGVASBN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|