About 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one
4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one (PubChem CID 53302190) has the molecular formula C12H15N3O4
and a molecular weight of 265.27 g/mol. Its IUPAC name is 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 53302190 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one |
| SMILES | COc1ccc2ncc(=O)n(CC(OC)OC)c2n1 |
| InChI | InChI=1S/C12H15N3O4/c1-17-9-5-4-8-12(14-9)15(10(16)6-13-8)7-11(18-2)19-3/h4-6,11H,7H2,1-3H3 |
| InChIKey | HMRJUDFHCBNLGM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one (CID 53302190) is 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one is COc1ccc2ncc(=O)n(CC(OC)OC)c2n1.
What is the InChIKey of 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one?
The InChIKey is HMRJUDFHCBNLGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O4/c1-17-9-5-4-8-12(14-9)15(10(16)6-13-8)7-11(18-2)19-3/h4-6,11H,7H2,1-3H3.
What are the key properties of 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one?
4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one has a molecular weight of 265.27 g/mol, XLogP of 0.42, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethoxyethyl)-6-methoxypyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 53302190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).