C16H16N4O2 — CID 5330239
2-anilino-8-(2-methoxyethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 5330239) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-anilino-8-(2-methoxyethyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-anilino-8-(2-methoxyethyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5330239 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-anilino-8-(2-methoxyethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | COCCn1c(=O)ccc2cnc(Nc3ccccc3)nc21 |
| InChI | InChI=1S/C16H16N4O2/c1-22-10-9-20-14(21)8-7-12-11-17-16(19-15(12)20)18-13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,17,18,19) |
| InChIKey | WSYNWKIFVKWJSA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |