C20H12F3NO3S — CID 53302396
2,5-difluoro-5-(4-fluorophenyl)-3-(4-methoxyphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione (PubChem CID 53302396) has the molecular formula C20H12F3NO3S and a molecular weight of 403.38 g/mol. Its IUPAC name is 2,5-difluoro-5-(4-fluorophenyl)-3-(4-methoxyphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione.
| Compound Name | 2,5-difluoro-5-(4-fluorophenyl)-3-(4-methoxyphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione |
|---|---|
| PubChem CID | 53302396 |
| Molecular Formula | C20H12F3NO3S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 2,5-difluoro-5-(4-fluorophenyl)-3-(4-methoxyphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione |
| SMILES | COc1ccc(-c2c(F)sc3c2C(=O)C(F)(c2ccc(F)cc2)C(=O)N3)cc1 |
| InChI | InChI=1S/C20H12F3NO3S/c1-27-13-8-2-10(3-9-13)14-15-16(25)20(23,11-4-6-12(21)7-5-11)19(26)24-18(15)28-17(14)22/h2-9H,1H3,(H,24,26) |
| InChIKey | PXXWPYMMGQJDEC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|