C17H18N4O2 — CID 5330240
2-anilino-8-(2-ethoxyethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 5330240) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-anilino-8-(2-ethoxyethyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-anilino-8-(2-ethoxyethyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5330240 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-anilino-8-(2-ethoxyethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCOCCn1c(=O)ccc2cnc(Nc3ccccc3)nc21 |
| InChI | InChI=1S/C17H18N4O2/c1-2-23-11-10-21-15(22)9-8-13-12-18-17(20-16(13)21)19-14-6-4-3-5-7-14/h3-9,12H,2,10-11H2,1H3,(H,18,19,20) |
| InChIKey | ORVZGMRYPIALKB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|