C20H12Cl2FNO3S — CID 53302501
2,5-dichloro-3-(3-fluoro-2-hydroxy-4-methylphenyl)-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione (PubChem CID 53302501) has the molecular formula C20H12Cl2FNO3S and a molecular weight of 436.29 g/mol. Its IUPAC name is 2,5-dichloro-3-(3-fluoro-2-hydroxy-4-methylphenyl)-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione.
| Compound Name | 2,5-dichloro-3-(3-fluoro-2-hydroxy-4-methylphenyl)-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione |
|---|---|
| PubChem CID | 53302501 |
| Molecular Formula | C20H12Cl2FNO3S |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | 2,5-dichloro-3-(3-fluoro-2-hydroxy-4-methylphenyl)-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione |
| SMILES | Cc1ccc(-c2c(Cl)sc3c2C(=O)C(Cl)(c2ccccc2)C(=O)N3)c(O)c1F |
| InChI | InChI=1S/C20H12Cl2FNO3S/c1-9-7-8-11(15(25)14(9)23)12-13-16(26)20(22,10-5-3-2-4-6-10)19(27)24-18(13)28-17(12)21/h2-8,25H,1H3,(H,24,27) |
| InChIKey | RRARAOIVURBZBI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|