About N8 Pyrido[2,3-d]pyrimidin-7-one deriv. 65
N8 Pyrido[2,3-d]pyrimidin-7-one deriv. 65 (PubChem CID 5330251) has the molecular formula C21H24N6O
and a molecular weight of 376.50 g/mol. Its IUPAC name is 8-cyclopropyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | N8 Pyrido[2,3-d]pyrimidin-7-one deriv. 65 |
| PubChem CID | 5330251 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 8-cyclopropyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C4C=CC(=O)N(C4=N3)C5CC5 |
| InChI | InChI=1S/C21H24N6O/c1-25-10-12-26(13-11-25)17-5-3-16(4-6-17)23-21-22-14-15-2-9-19(28)27(18-7-8-18)20(15)24-21/h2-6,9,14,18H,7-8,10-13H2,1H3,(H,22,23,24) |
| InChIKey | REDXWYHSSILFOH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | 592 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N8 Pyrido[2,3-d]pyrimidin-7-one deriv. 65 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N8 Pyrido[2,3-d]pyrimidin-7-one deriv. 65?
The IUPAC name of N8 Pyrido[2,3-d]pyrimidin-7-one deriv. 65 (CID 5330251) is 8-cyclopropyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for N8 Pyrido[2,3-d]pyrimidin-7-one deriv. 65?
The canonical SMILES for N8 Pyrido[2,3-d]pyrimidin-7-one deriv. 65 is CN1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C4C=CC(=O)N(C4=N3)C5CC5.
What is the InChIKey of N8 Pyrido[2,3-d]pyrimidin-7-one deriv. 65?
The InChIKey is REDXWYHSSILFOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N6O/c1-25-10-12-26(13-11-25)17-5-3-16(4-6-17)23-21-22-14-15-2-9-19(28)27(18-7-8-18)20(15)24-21/h2-6,9,14,18H,7-8,10-13H2,1H3,(H,22,23,24).
What are the key properties of N8 Pyrido[2,3-d]pyrimidin-7-one deriv. 65?
N8 Pyrido[2,3-d]pyrimidin-7-one deriv. 65 has a molecular weight of 376.50 g/mol, XLogP of 2.50, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N8 Pyrido[2,3-d]pyrimidin-7-one deriv. 65 is sourced from PubChem (CID 5330251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).