C25H33N7O2 — CID 5330273
8-cyclopentyl-6-(2-ethoxyethyl)-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 5330273) has the molecular formula C25H33N7O2 and a molecular weight of 463.59 g/mol. Its IUPAC name is 8-cyclopentyl-6-(2-ethoxyethyl)-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-6-(2-ethoxyethyl)-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5330273 |
| Molecular Formula | C25H33N7O2 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | 8-cyclopentyl-6-(2-ethoxyethyl)-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCOCCc1cc2cnc(Nc3ccc(N4CCNCC4)cn3)nc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C25H33N7O2/c1-2-34-14-9-18-15-19-16-28-25(30-23(19)32(24(18)33)20-5-3-4-6-20)29-22-8-7-21(17-27-22)31-12-10-26-11-13-31/h7-8,15-17,20,26H,2-6,9-14H2,1H3,(H,27,28,29,30) |
| InChIKey | IXNAAXCEGIMPJY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|