C17H19NO3 — CID 53302835
(2E,4E)-5-(1,3-benzodioxol-5-yl)-N-cyclopentylpenta-2,4-dienamide (PubChem CID 53302835) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-cyclopentylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-cyclopentylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 53302835 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-cyclopentylpenta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)NC1CCCC1 |
| InChI | InChI=1S/C17H19NO3/c19-17(18-14-6-2-3-7-14)8-4-1-5-13-9-10-15-16(11-13)21-12-20-15/h1,4-5,8-11,14H,2-3,6-7,12H2,(H,18,19)/b5-1+,8-4+ |
| InChIKey | MJFAETNOKFXZAB-LZSLGQGWSA-N |
| XLogP | 3.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|