About trihexyl(octoxy)silane
trihexyl(octoxy)silane (PubChem CID 533029) has the molecular formula C26H56OSi
and a molecular weight of 412.82 g/mol. Its IUPAC name is trihexyl(octoxy)silane.
Molecular Properties
| Compound Name | trihexyl(octoxy)silane |
| PubChem CID | 533029 |
| Molecular Formula | C26H56OSi |
| Molecular Weight | 412.82 g/mol |
| Exact Mass | 412.41 |
| IUPAC Name | trihexyl(octoxy)silane |
| SMILES | CCCCCCCCO[Si](CCCCCC)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C26H56OSi/c1-5-9-13-17-18-19-23-27-28(24-20-14-10-6-2,25-21-15-11-7-3)26-22-16-12-8-4/h5-26H2,1-4H3 |
| InChIKey | OJIYLDKHFBOSTR-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.82 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trihexyl(octoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trihexyl(octoxy)silane?
The IUPAC name of trihexyl(octoxy)silane (CID 533029) is trihexyl(octoxy)silane.
What is the SMILES notation for trihexyl(octoxy)silane?
The canonical SMILES for trihexyl(octoxy)silane is CCCCCCCCO[Si](CCCCCC)(CCCCCC)CCCCCC.
What is the InChIKey of trihexyl(octoxy)silane?
The InChIKey is OJIYLDKHFBOSTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H56OSi/c1-5-9-13-17-18-19-23-27-28(24-20-14-10-6-2,25-21-15-11-7-3)26-22-16-12-8-4/h5-26H2,1-4H3.
What are the key properties of trihexyl(octoxy)silane?
trihexyl(octoxy)silane has a molecular weight of 412.82 g/mol, XLogP of 10.05, 23 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trihexyl(octoxy)silane is sourced from PubChem (CID 533029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).