About 2-Aminoquinazoline 11
2-Aminoquinazoline 11 (PubChem CID 5330310) has the molecular formula C22H27N5O
and a molecular weight of 377.50 g/mol. Its IUPAC name is 7-methoxy-N-(4-piperazin-1-ylphenyl)-8-propan-2-ylquinazolin-2-amine.
Molecular Properties
| Compound Name | 2-Aminoquinazoline 11 |
| PubChem CID | 5330310 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 7-methoxy-N-(4-piperazin-1-ylphenyl)-8-propan-2-ylquinazolin-2-amine |
| SMILES | CC(C)C1=C(C=CC2=CN=C(N=C21)NC3=CC=C(C=C3)N4CCNCC4)OC |
| InChI | InChI=1S/C22H27N5O/c1-15(2)20-19(28-3)9-4-16-14-24-22(26-21(16)20)25-17-5-7-18(8-6-17)27-12-10-23-11-13-27/h4-9,14-15,23H,10-13H2,1-3H3,(H,24,25,26) |
| InChIKey | MVYCYUJGCLLOSV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | 476 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 2-Aminoquinazoline 11 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Aminoquinazoline 11?
The IUPAC name of 2-Aminoquinazoline 11 (CID 5330310) is 7-methoxy-N-(4-piperazin-1-ylphenyl)-8-propan-2-ylquinazolin-2-amine.
What is the SMILES notation for 2-Aminoquinazoline 11?
The canonical SMILES for 2-Aminoquinazoline 11 is CC(C)C1=C(C=CC2=CN=C(N=C21)NC3=CC=C(C=C3)N4CCNCC4)OC.
What is the InChIKey of 2-Aminoquinazoline 11?
The InChIKey is MVYCYUJGCLLOSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N5O/c1-15(2)20-19(28-3)9-4-16-14-24-22(26-21(16)20)25-17-5-7-18(8-6-17)27-12-10-23-11-13-27/h4-9,14-15,23H,10-13H2,1-3H3,(H,24,25,26).
What are the key properties of 2-Aminoquinazoline 11?
2-Aminoquinazoline 11 has a molecular weight of 377.50 g/mol, XLogP of 4.00, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Aminoquinazoline 11 is sourced from PubChem (CID 5330310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).