C25H32N6O — CID 5330349
8-cyclopentyl-2-[4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]anilino]-5-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 5330349) has the molecular formula C25H32N6O and a molecular weight of 432.57 g/mol. Its IUPAC name is 8-cyclopentyl-2-[4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]anilino]-5-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-2-[4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]anilino]-5-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5330349 |
| Molecular Formula | C25H32N6O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 8-cyclopentyl-2-[4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]anilino]-5-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n(C2CCCC2)c2nc(Nc3ccc(N4C[C@@H](C)N[C@@H](C)C4)cc3)ncc12 |
| InChI | InChI=1S/C25H32N6O/c1-16-12-23(32)31(21-6-4-5-7-21)24-22(16)13-26-25(29-24)28-19-8-10-20(11-9-19)30-14-17(2)27-18(3)15-30/h8-13,17-18,21,27H,4-7,14-15H2,1-3H3,(H,26,28,29)/t17-,18+ |
| InChIKey | NBQXGCYGWSWENM-HDICACEKSA-N |
| XLogP | 4.15 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|