C24H30N6O — CID 5330352
8-cyclopentyl-5,6-dimethyl-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 5330352) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 8-cyclopentyl-5,6-dimethyl-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-5,6-dimethyl-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5330352 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 8-cyclopentyl-5,6-dimethyl-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1c(C)c2cnc(Nc3ccc(N4CCNCC4)cc3)nc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C24H30N6O/c1-16-17(2)23(31)30(20-5-3-4-6-20)22-21(16)15-26-24(28-22)27-18-7-9-19(10-8-18)29-13-11-25-12-14-29/h7-10,15,20,25H,3-6,11-14H2,1-2H3,(H,26,27,28) |
| InChIKey | BTIKBNRXWBVMSS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|