About [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid
[3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid (PubChem CID 53303636) has the molecular formula C16H21N3O7
and a molecular weight of 367.36 g/mol. Its IUPAC name is [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid.
Molecular Properties
| Compound Name | [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid |
| PubChem CID | 53303636 |
| Molecular Formula | C16H21N3O7 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid |
| SMILES | NCC1CC2CC2N1C(=O)c1ccccn1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C12H15N3O.C4H6O6/c13-7-9-5-8-6-11(8)15(9)12(16)10-3-1-2-4-14-10;5-1(3(7)8)2(6)4(9)10/h1-4,8-9,11H,5-7,13H2;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | GBHKSEPEZRJMSP-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid?
The IUPAC name of [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid (CID 53303636) is [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid.
What is the SMILES notation for [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid?
The canonical SMILES for [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid is NCC1CC2CC2N1C(=O)c1ccccn1.O=C(O)C(O)C(O)C(=O)O.
What is the InChIKey of [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid?
The InChIKey is GBHKSEPEZRJMSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O.C4H6O6/c13-7-9-5-8-6-11(8)15(9)12(16)10-3-1-2-4-14-10;5-1(3(7)8)2(6)4(9)10/h1-4,8-9,11H,5-7,13H2;1-2,5-6H,(H,7,8)(H,9,10).
What are the key properties of [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid?
[3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid has a molecular weight of 367.36 g/mol, XLogP of -1.48, 5 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(aminomethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-pyridin-2-ylmethanone;2,3-dihydroxybutanedioic acid is sourced from PubChem (CID 53303636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).