About N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine
N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine (PubChem CID 5330364) has the molecular formula C23H20Cl2N6
and a molecular weight of 451.36 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine |
| PubChem CID | 5330364 |
| Molecular Formula | C23H20Cl2N6 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine |
| SMILES | Clc1ccc(Nc2cncc(-c3cncc(NCCCc4ccncc4)c3)n2)cc1Cl |
| InChI | InChI=1S/C23H20Cl2N6/c24-20-4-3-18(11-21(20)25)30-23-15-28-14-22(31-23)17-10-19(13-27-12-17)29-7-1-2-16-5-8-26-9-6-16/h3-6,8-15,29H,1-2,7H2,(H,30,31) |
| InChIKey | WDJAMFCUZITORN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine?
The IUPAC name of N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine (CID 5330364) is N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine.
What is the SMILES notation for N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine?
The canonical SMILES for N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine is Clc1ccc(Nc2cncc(-c3cncc(NCCCc4ccncc4)c3)n2)cc1Cl.
What is the InChIKey of N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine?
The InChIKey is WDJAMFCUZITORN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20Cl2N6/c24-20-4-3-18(11-21(20)25)30-23-15-28-14-22(31-23)17-10-19(13-27-12-17)29-7-1-2-16-5-8-26-9-6-16/h3-6,8-15,29H,1-2,7H2,(H,30,31).
What are the key properties of N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine?
N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine has a molecular weight of 451.36 g/mol, XLogP of 6.03, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dichlorophenyl)-6-[5-(3-pyridin-4-ylpropylamino)-3-pyridinyl]pyrazin-2-amine is sourced from PubChem (CID 5330364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).