About benzyl 2-phenylsulfanylacetate
benzyl 2-phenylsulfanylacetate (PubChem CID 533037) has the molecular formula C15H14O2S
and a molecular weight of 258.34 g/mol. Its IUPAC name is benzyl 2-phenylsulfanylacetate.
Molecular Properties
| Compound Name | benzyl 2-phenylsulfanylacetate |
| PubChem CID | 533037 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | benzyl 2-phenylsulfanylacetate |
| SMILES | O=C(CSc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C15H14O2S/c16-15(12-18-14-9-5-2-6-10-14)17-11-13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | HFNGWLVGBRAPAH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 2-phenylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-phenylsulfanylacetate?
The IUPAC name of benzyl 2-phenylsulfanylacetate (CID 533037) is benzyl 2-phenylsulfanylacetate.
What is the SMILES notation for benzyl 2-phenylsulfanylacetate?
The canonical SMILES for benzyl 2-phenylsulfanylacetate is O=C(CSc1ccccc1)OCc1ccccc1.
What is the InChIKey of benzyl 2-phenylsulfanylacetate?
The InChIKey is HFNGWLVGBRAPAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2S/c16-15(12-18-14-9-5-2-6-10-14)17-11-13-7-3-1-4-8-13/h1-10H,11-12H2.
What are the key properties of benzyl 2-phenylsulfanylacetate?
benzyl 2-phenylsulfanylacetate has a molecular weight of 258.34 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-phenylsulfanylacetate is sourced from PubChem (CID 533037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).