C23H27ClN6 — CID 5330381
N-(3-chlorophenyl)-6-[5-(3-piperidin-1-ylpropylamino)-3-pyridinyl]pyrazin-2-amine (PubChem CID 5330381) has the molecular formula C23H27ClN6 and a molecular weight of 422.96 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6-[5-(3-piperidin-1-ylpropylamino)-3-pyridinyl]pyrazin-2-amine.
| Compound Name | N-(3-chlorophenyl)-6-[5-(3-piperidin-1-ylpropylamino)-3-pyridinyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 5330381 |
| Molecular Formula | C23H27ClN6 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-(3-chlorophenyl)-6-[5-(3-piperidin-1-ylpropylamino)-3-pyridinyl]pyrazin-2-amine |
| SMILES | Clc1cccc(Nc2cncc(-c3cncc(NCCCN4CCCCC4)c3)n2)c1 |
| InChI | InChI=1S/C23H27ClN6/c24-19-6-4-7-20(13-19)28-23-17-26-16-22(29-23)18-12-21(15-25-14-18)27-8-5-11-30-9-2-1-3-10-30/h4,6-7,12-17,27H,1-3,5,8-11H2,(H,28,29) |
| InChIKey | SQOMHHDPYUXRBG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|