C29H29FN6O2 — CID 53303867
6-[4-(6-fluoro-1H-benzimidazol-2-yl)piperazin-1-yl]-3-[(1S,2S)-2-hydroxycyclohexyl]benzo[h]quinazolin-4-one (PubChem CID 53303867) has the molecular formula C29H29FN6O2 and a molecular weight of 512.59 g/mol. Its IUPAC name is 6-[4-(6-fluoro-1H-benzimidazol-2-yl)piperazin-1-yl]-3-[(1S,2S)-2-hydroxycyclohexyl]benzo[h]quinazolin-4-one.
| Compound Name | 6-[4-(6-fluoro-1H-benzimidazol-2-yl)piperazin-1-yl]-3-[(1S,2S)-2-hydroxycyclohexyl]benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 53303867 |
| Molecular Formula | C29H29FN6O2 |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 6-[4-(6-fluoro-1H-benzimidazol-2-yl)piperazin-1-yl]-3-[(1S,2S)-2-hydroxycyclohexyl]benzo[h]quinazolin-4-one |
| SMILES | O=c1c2cc(N3CCN(c4nc5ccc(F)cc5[nH]4)CC3)c3ccccc3c2ncn1[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C29H29FN6O2/c30-18-9-10-22-23(15-18)33-29(32-22)35-13-11-34(12-14-35)25-16-21-27(20-6-2-1-5-19(20)25)31-17-36(28(21)38)24-7-3-4-8-26(24)37/h1-2,5-6,9-10,15-17,24,26,37H,3-4,7-8,11-14H2,(H,32,33)/t24-,26-/m0/s1 |
| InChIKey | PDSSYIBJHQXLEF-AHWVRZQESA-N |
| XLogP | 4.37 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|