C20H19ClN8 — CID 5330392
N-(3-chlorophenyl)-6-[5-[3-(1,2,4-triazol-1-yl)propylamino]-3-pyridinyl]pyrazin-2-amine (PubChem CID 5330392) has the molecular formula C20H19ClN8 and a molecular weight of 406.88 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6-[5-[3-(1,2,4-triazol-1-yl)propylamino]-3-pyridinyl]pyrazin-2-amine.
| Compound Name | N-(3-chlorophenyl)-6-[5-[3-(1,2,4-triazol-1-yl)propylamino]-3-pyridinyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 5330392 |
| Molecular Formula | C20H19ClN8 |
| Molecular Weight | 406.88 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-(3-chlorophenyl)-6-[5-[3-(1,2,4-triazol-1-yl)propylamino]-3-pyridinyl]pyrazin-2-amine |
| SMILES | Clc1cccc(Nc2cncc(-c3cncc(NCCCn4cncn4)c3)n2)c1 |
| InChI | InChI=1S/C20H19ClN8/c21-16-3-1-4-17(8-16)27-20-12-23-11-19(28-20)15-7-18(10-22-9-15)25-5-2-6-29-14-24-13-26-29/h1,3-4,7-14,25H,2,5-6H2,(H,27,28) |
| InChIKey | QGAMKOCDVQJIEP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|