C19H18FN3O2S — CID 53303985
11-(3-fluorophenyl)sulfonyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene (PubChem CID 53303985) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is 11-(3-fluorophenyl)sulfonyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene.
| Compound Name | 11-(3-fluorophenyl)sulfonyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene |
|---|---|
| PubChem CID | 53303985 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 11-(3-fluorophenyl)sulfonyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraene |
| SMILES | O=S(=O)(c1cccc(F)c1)n1cc2c3c(cccc31)N1CCNCC1C2 |
| InChI | InChI=1S/C19H18FN3O2S/c20-14-3-1-4-16(10-14)26(24,25)23-12-13-9-15-11-21-7-8-22(15)17-5-2-6-18(23)19(13)17/h1-6,10,12,15,21H,7-9,11H2 |
| InChIKey | FRDVOZMDNOYFJK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |