C14H22F3N3O2 — CID 53303988
1-hydroxy-3-methyl-4-[1-(2-methylpropyl)-3-(trifluoromethyl)pyrazol-5-yl]oxypiperidine (PubChem CID 53303988) has the molecular formula C14H22F3N3O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-hydroxy-3-methyl-4-[1-(2-methylpropyl)-3-(trifluoromethyl)pyrazol-5-yl]oxypiperidine.
| Compound Name | 1-hydroxy-3-methyl-4-[1-(2-methylpropyl)-3-(trifluoromethyl)pyrazol-5-yl]oxypiperidine |
|---|---|
| PubChem CID | 53303988 |
| Molecular Formula | C14H22F3N3O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-hydroxy-3-methyl-4-[1-(2-methylpropyl)-3-(trifluoromethyl)pyrazol-5-yl]oxypiperidine |
| SMILES | CC(C)Cn1nc(C(F)(F)F)cc1OC1CCN(O)CC1C |
| InChI | InChI=1S/C14H22F3N3O2/c1-9(2)7-20-13(6-12(18-20)14(15,16)17)22-11-4-5-19(21)8-10(11)3/h6,9-11,21H,4-5,7-8H2,1-3H3 |
| InChIKey | PWVOUYDHEPEUCH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |