About 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione
2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione (PubChem CID 53304106) has the molecular formula C21H15ClFNO2S
and a molecular weight of 399.87 g/mol. Its IUPAC name is 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione.
Molecular Properties
| Compound Name | 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione |
| PubChem CID | 53304106 |
| Molecular Formula | C21H15ClFNO2S |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione |
| SMILES | Cc1cccc(-c2c(Cl)sc3c2C(=O)C(C)(c2ccc(F)cc2)C(=O)N3)c1 |
| InChI | InChI=1S/C21H15ClFNO2S/c1-11-4-3-5-12(10-11)15-16-17(25)21(2,13-6-8-14(23)9-7-13)20(26)24-19(16)27-18(15)22/h3-10H,1-2H3,(H,24,26) |
| InChIKey | KBIOBIVEEMLDAO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione?
The IUPAC name of 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione (CID 53304106) is 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione.
What is the SMILES notation for 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione?
The canonical SMILES for 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione is Cc1cccc(-c2c(Cl)sc3c2C(=O)C(C)(c2ccc(F)cc2)C(=O)N3)c1.
What is the InChIKey of 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione?
The InChIKey is KBIOBIVEEMLDAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClFNO2S/c1-11-4-3-5-12(10-11)15-16-17(25)21(2,13-6-8-14(23)9-7-13)20(26)24-19(16)27-18(15)22/h3-10H,1-2H3,(H,24,26).
What are the key properties of 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione?
2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione has a molecular weight of 399.87 g/mol, XLogP of 5.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(4-fluorophenyl)-5-methyl-3-(3-methylphenyl)-7H-thieno[2,3-b]pyridine-4,6-dione is sourced from PubChem (CID 53304106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).