About 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one
4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one (PubChem CID 53304131) has the molecular formula C23H31NO2
and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one |
| PubChem CID | 53304131 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one |
| SMILES | CC(C)c1c(O[C@@H]2CCCC[C@H]2C)cc(CCc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C23H31NO2/c1-16(2)22-21(26-20-12-8-7-9-17(20)3)15-19(24-23(22)25)14-13-18-10-5-4-6-11-18/h4-6,10-11,15-17,20H,7-9,12-14H2,1-3H3,(H,24,25)/t17-,20-/m1/s1 |
| InChIKey | TWHPGIQZGKDNQM-YLJYHZDGSA-N |
| XLogP | 5.24 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one?
The IUPAC name of 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one (CID 53304131) is 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one.
What is the SMILES notation for 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one?
The canonical SMILES for 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one is CC(C)c1c(O[C@@H]2CCCC[C@H]2C)cc(CCc2ccccc2)[nH]c1=O.
What is the InChIKey of 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one?
The InChIKey is TWHPGIQZGKDNQM-YLJYHZDGSA-N. The full InChI is InChI=1S/C23H31NO2/c1-16(2)22-21(26-20-12-8-7-9-17(20)3)15-19(24-23(22)25)14-13-18-10-5-4-6-11-18/h4-6,10-11,15-17,20H,7-9,12-14H2,1-3H3,(H,24,25)/t17-,20-/m1/s1.
What are the key properties of 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one?
4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one has a molecular weight of 353.51 g/mol, XLogP of 5.24, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R,2R)-2-methylcyclohexyl]oxy-6-(2-phenylethyl)-3-propan-2-yl-1H-pyridin-2-one is sourced from PubChem (CID 53304131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).